2-Chloro-5-iodobenzoic acid (CAS No: 19094-56-5) is a key pharmaceutical intermediate used in the synthesis of APIs Empagliflozin. This compound serves as an essential raw material in API development and synthesis. Explore detailed chemical properties, molecular data, structure information, and verified global suppliers, manufacturers, and distributors of this API intermediate on apicule.
Alternate Names: 5-iodo-2-chlorobenzoic acid, Empagliflozin Impurity 28, B-(2-Chloro-5-iodophenyl)boronic acid
CAS No: 19094-56-5
PubChem CID: 519638
Mol Formula: C7H4ClIO2
Mol Weight: 282.46 g/mol
Used in API: Empagliflozin
IUPAC Name: 2-chloro-5-iodobenzoic acid
API Intermediate Description: 2-Chloro-5-iodobenzoic acid (CIBA) is primarily used as a key pharmaceutical intermediate, especially for synthesizing modern anti-diabetic drugs (like SGLT2 inhibitors), but also serves as a versatile scaffold in organic chemistry for creating complex molecules, including potential anti-inflammatory agents, materials, and probes for biochemical research. Its reactive chlorine and iodine groups make it valuable in synthesizing new compounds for medicine, agrochemicals, and materials science.
